C8H6N2O2S — CID 102387545
(5Z)-5-(furan-3-ylmethylidene)-2-sulfanylideneimidazolidin-4-one (PubChem CID 102387545) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is (5Z)-5-(furan-3-ylmethylidene)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-(furan-3-ylmethylidene)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 102387545 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | (5Z)-5-(furan-3-ylmethylidene)-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C\c1ccoc1 |
| InChI | InChI=1S/C8H6N2O2S/c11-7-6(9-8(13)10-7)3-5-1-2-12-4-5/h1-4H,(H2,9,10,11,13)/b6-3- |
| InChIKey | BLFUMKPSVDUTPH-UTCJRWHESA-N |
| XLogP | 0.62 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|