About 4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide
4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide (PubChem CID 10238782) has the molecular formula C23H21F3N4O4
and a molecular weight of 474.40 g/mol. Its IUPAC name is N-ethyl-4-[4-[[2-methoxy-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide |
| PubChem CID | 10238782 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-ethyl-4-[4-[[2-methoxy-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide |
| SMILES | CCNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=C(C=CC(=C3)C(F)(F)F)OC |
| InChI | InChI=1S/C23H21F3N4O4/c1-3-27-21(31)19-13-17(10-11-28-19)34-16-7-5-15(6-8-16)29-22(32)30-18-12-14(23(24,25)26)4-9-20(18)33-2/h4-13H,3H2,1-2H3,(H,27,31)(H2,29,30,32) |
| InChIKey | OBRXWZRFHKQFNQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 102.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | 673 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide?
The IUPAC name of 4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide (CID 10238782) is N-ethyl-4-[4-[[2-methoxy-5-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]pyridine-2-carboxamide.
What is the SMILES notation for 4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide?
The canonical SMILES for 4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide is CCNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=C(C=CC(=C3)C(F)(F)F)OC.
What is the InChIKey of 4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide?
The InChIKey is OBRXWZRFHKQFNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F3N4O4/c1-3-27-21(31)19-13-17(10-11-28-19)34-16-7-5-15(6-8-16)29-22(32)30-18-12-14(23(24,25)26)4-9-20(18)33-2/h4-13H,3H2,1-2H3,(H,27,31)(H2,29,30,32).
What are the key properties of 4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide?
4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide has a molecular weight of 474.40 g/mol, XLogP of 3.80, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-{4-[3-(2-Methoxy-5-trifluoromethyl-phenyl)-ureido]-phenoxy}-pyridine-2-carboxylic acid ethylamide is sourced from PubChem (CID 10238782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).