About (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran
(2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran (PubChem CID 102388136) has the molecular formula C16H22O2S
and a molecular weight of 278.42 g/mol. Its IUPAC name is (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran |
| PubChem CID | 102388136 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran |
| SMILES | CCCC[C@@H]1OCC=C[C@H]1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O2S/c1-3-4-6-15-16(7-5-12-18-15)19(17)14-10-8-13(2)9-11-14/h5,7-11,15-16H,3-4,6,12H2,1-2H3/t15-,16+,19?/m0/s1 |
| InChIKey | UPVFIQZUTMASLK-GWFKTICUSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran?
The IUPAC name of (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran (CID 102388136) is (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran?
The canonical SMILES for (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran is CCCC[C@@H]1OCC=C[C@H]1S(=O)c1ccc(C)cc1.
What is the InChIKey of (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran?
The InChIKey is UPVFIQZUTMASLK-GWFKTICUSA-N. The full InChI is InChI=1S/C16H22O2S/c1-3-4-6-15-16(7-5-12-18-15)19(17)14-10-8-13(2)9-11-14/h5,7-11,15-16H,3-4,6,12H2,1-2H3/t15-,16+,19?/m0/s1.
What are the key properties of (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran?
(2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran has a molecular weight of 278.42 g/mol, XLogP of 3.62, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-butyl-3-(4-methylphenyl)sulfinyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 102388136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).