C27H32N4O4 — CID 10238825
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-3-[[2-(4-methoxyphenyl)acetyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxamide (PubChem CID 10238825) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-3-[[2-(4-methoxyphenyl)acetyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxamide.
| Compound Name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-3-[[2-(4-methoxyphenyl)acetyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 10238825 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-3-[[2-(4-methoxyphenyl)acetyl]amino]-1,2,4,9-tetrahydrocarbazole-3-carboxamide |
| SMILES | COc1ccc(CC(=O)NC2(C(=O)N[C@H](C(N)=O)C(C)C)CCc3[nH]c4ccccc4c3C2)cc1 |
| InChI | InChI=1S/C27H32N4O4/c1-16(2)24(25(28)33)30-26(34)27(31-23(32)14-17-8-10-18(35-3)11-9-17)13-12-22-20(15-27)19-6-4-5-7-21(19)29-22/h4-11,16,24,29H,12-15H2,1-3H3,(H2,28,33)(H,30,34)(H,31,32)/t24-,27?/m0/s1 |
| InChIKey | WRURBELQCKTMFX-BXXZMZEQSA-N |
| XLogP | 2.39 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|