C25H20O2S8 — CID 102388318
[2-(5,6-diphenyl-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-6-(hydroxymethyl)-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-6-yl]methanol (PubChem CID 102388318) has the molecular formula C25H20O2S8 and a molecular weight of 608.97 g/mol. Its IUPAC name is [2-(5,6-diphenyl-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-6-(hydroxymethyl)-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-6-yl]methanol.
| Compound Name | [2-(5,6-diphenyl-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-6-(hydroxymethyl)-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-6-yl]methanol |
|---|---|
| PubChem CID | 102388318 |
| Molecular Formula | C25H20O2S8 |
| Molecular Weight | 608.97 g/mol |
| Exact Mass | 607.92 |
| IUPAC Name | [2-(5,6-diphenyl-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-6-(hydroxymethyl)-5,7-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiepin-6-yl]methanol |
| SMILES | OCC1(CO)CSC2=C(SC1)SC(=C1SC3=C(S1)SC(c1ccccc1)=C(c1ccccc1)S3)S2 |
| InChI | InChI=1S/C25H20O2S8/c26-11-25(12-27)13-28-19-20(29-14-25)33-23(32-19)24-34-21-22(35-24)31-18(16-9-5-2-6-10-16)17(30-21)15-7-3-1-4-8-15/h1-10,26-27H,11-14H2 |
| InChIKey | DTQDGDPTVAWDFQ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.97 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|