C17H31NO2S — CID 102388635
N-(1-but-3-enyl-2-butylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide (PubChem CID 102388635) has the molecular formula C17H31NO2S and a molecular weight of 313.51 g/mol. Its IUPAC name is N-(1-but-3-enyl-2-butylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide.
| Compound Name | N-(1-but-3-enyl-2-butylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 102388635 |
| Molecular Formula | C17H31NO2S |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | N-(1-but-3-enyl-2-butylcyclopent-2-en-1-yl)-2-methylpropane-2-sulfonamide |
| SMILES | C=CCCC1(NS(=O)(=O)C(C)(C)C)CCC=C1CCCC |
| InChI | InChI=1S/C17H31NO2S/c1-6-8-11-15-12-10-14-17(15,13-9-7-2)18-21(19,20)16(3,4)5/h7,12,18H,2,6,8-11,13-14H2,1,3-5H3 |
| InChIKey | DXMYELZYGKZISG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|