About benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate
benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate (PubChem CID 102388754) has the molecular formula C17H16F3NO4
and a molecular weight of 355.31 g/mol. Its IUPAC name is benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate |
| PubChem CID | 102388754 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)OC(c1c[nH]c(C(=O)OCc2ccccc2)c1C)C(F)(F)F |
| InChI | InChI=1S/C17H16F3NO4/c1-10-13(15(17(18,19)20)25-11(2)22)8-21-14(10)16(23)24-9-12-6-4-3-5-7-12/h3-8,15,21H,9H2,1-2H3 |
| InChIKey | QVPVELKQYHXSCU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate?
The IUPAC name of benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate (CID 102388754) is benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate.
What is the SMILES notation for benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate?
The canonical SMILES for benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate is CC(=O)OC(c1c[nH]c(C(=O)OCc2ccccc2)c1C)C(F)(F)F.
What is the InChIKey of benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate?
The InChIKey is QVPVELKQYHXSCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F3NO4/c1-10-13(15(17(18,19)20)25-11(2)22)8-21-14(10)16(23)24-9-12-6-4-3-5-7-12/h3-8,15,21H,9H2,1-2H3.
What are the key properties of benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate?
benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate has a molecular weight of 355.31 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(1-acetyloxy-2,2,2-trifluoroethyl)-3-methyl-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 102388754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).