C10H17O3P — CID 102388814
(1R,4S,5S,6R)-5-dimethoxyphosphoryl-6-methylbicyclo[2.2.1]hept-2-ene (PubChem CID 102388814) has the molecular formula C10H17O3P and a molecular weight of 216.22 g/mol. Its IUPAC name is (1R,4S,5S,6R)-5-dimethoxyphosphoryl-6-methylbicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5S,6R)-5-dimethoxyphosphoryl-6-methylbicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 102388814 |
| Molecular Formula | C10H17O3P |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (1R,4S,5S,6R)-5-dimethoxyphosphoryl-6-methylbicyclo[2.2.1]hept-2-ene |
| SMILES | COP(=O)(OC)[C@H]1[C@H](C)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C10H17O3P/c1-7-8-4-5-9(6-8)10(7)14(11,12-2)13-3/h4-5,7-10H,6H2,1-3H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | JJWSBWBKRSEKNB-RGOKHQFPSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|