C21H22N4O — CID 102389474
10,16-bis(prop-2-enyl)-18-oxa-5,8,10,16-tetrazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2(7),3,5,12,14(19)-hexaene (PubChem CID 102389474) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 10,16-bis(prop-2-enyl)-18-oxa-5,8,10,16-tetrazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2(7),3,5,12,14(19)-hexaene.
| Compound Name | 10,16-bis(prop-2-enyl)-18-oxa-5,8,10,16-tetrazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2(7),3,5,12,14(19)-hexaene |
|---|---|
| PubChem CID | 102389474 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 10,16-bis(prop-2-enyl)-18-oxa-5,8,10,16-tetrazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2(7),3,5,12,14(19)-hexaene |
| SMILES | C=CCN1COc2c(cc3c4c2c2ccncc2n4CN(CC=C)C3)C1 |
| InChI | InChI=1S/C21H22N4O/c1-3-7-23-11-15-9-16-12-24(8-4-2)14-26-21(16)19-17-5-6-22-10-18(17)25(13-23)20(15)19/h3-6,9-10H,1-2,7-8,11-14H2 |
| InChIKey | VWTNAZZVRMYERL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|