C15H20O5 — CID 102390171
3-[(1R,5S,6R,9R)-5,9-dimethyl-4-oxo-8,10-dioxatricyclo[7.2.1.01,6]dodec-2-en-5-yl]propanoic acid (PubChem CID 102390171) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-[(1R,5S,6R,9R)-5,9-dimethyl-4-oxo-8,10-dioxatricyclo[7.2.1.01,6]dodec-2-en-5-yl]propanoic acid.
| Compound Name | 3-[(1R,5S,6R,9R)-5,9-dimethyl-4-oxo-8,10-dioxatricyclo[7.2.1.01,6]dodec-2-en-5-yl]propanoic acid |
|---|---|
| PubChem CID | 102390171 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-[(1R,5S,6R,9R)-5,9-dimethyl-4-oxo-8,10-dioxatricyclo[7.2.1.01,6]dodec-2-en-5-yl]propanoic acid |
| SMILES | C[C@@]12C[C@]3(C=CC(=O)[C@@](C)(CCC(=O)O)[C@@H]3CO1)CO2 |
| InChI | InChI=1S/C15H20O5/c1-13(5-4-12(17)18)10-7-19-14(2)8-15(10,9-20-14)6-3-11(13)16/h3,6,10H,4-5,7-9H2,1-2H3,(H,17,18)/t10-,13-,14+,15+/m0/s1 |
| InChIKey | MXFAHTKCSDPGSK-BSLXNSKLSA-N |
| XLogP | 1.77 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |