C16H15F3O3S — CID 102390275
2-(benzenesulfonyl)-1-[(1S,2R,3R,4R)-3-(trifluoromethyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone (PubChem CID 102390275) has the molecular formula C16H15F3O3S and a molecular weight of 344.35 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[(1S,2R,3R,4R)-3-(trifluoromethyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone.
| Compound Name | 2-(benzenesulfonyl)-1-[(1S,2R,3R,4R)-3-(trifluoromethyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
|---|---|
| PubChem CID | 102390275 |
| Molecular Formula | C16H15F3O3S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[(1S,2R,3R,4R)-3-(trifluoromethyl)-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)[C@H]1[C@H](C(F)(F)F)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C16H15F3O3S/c17-16(18,19)15-11-7-6-10(8-11)14(15)13(20)9-23(21,22)12-4-2-1-3-5-12/h1-7,10-11,14-15H,8-9H2/t10-,11+,14+,15-/m1/s1 |
| InChIKey | YSSDPLHXOYFCCO-FDRIWYBQSA-N |
| XLogP | 3.03 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|