C32H34O6 — CID 102390284
dibenzyl 2-[2-(4-methoxyphenyl)-2-(2-oxocyclohexyl)ethyl]propanedioate (PubChem CID 102390284) has the molecular formula C32H34O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is dibenzyl 2-[2-(4-methoxyphenyl)-2-(2-oxocyclohexyl)ethyl]propanedioate.
| Compound Name | dibenzyl 2-[2-(4-methoxyphenyl)-2-(2-oxocyclohexyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 102390284 |
| Molecular Formula | C32H34O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | dibenzyl 2-[2-(4-methoxyphenyl)-2-(2-oxocyclohexyl)ethyl]propanedioate |
| SMILES | COc1ccc(C(CC(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)C2CCCCC2=O)cc1 |
| InChI | InChI=1S/C32H34O6/c1-36-26-18-16-25(17-19-26)28(27-14-8-9-15-30(27)33)20-29(31(34)37-21-23-10-4-2-5-11-23)32(35)38-22-24-12-6-3-7-13-24/h2-7,10-13,16-19,27-29H,8-9,14-15,20-22H2,1H3 |
| InChIKey | BGYPXWKFRVQACI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|