C14H16F3NO2 — CID 102390311
(5R)-1-[(3-methoxyphenyl)methyl]-3-methyl-5-(trifluoromethyl)pyrrolidin-2-one (PubChem CID 102390311) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is (5R)-1-[(3-methoxyphenyl)methyl]-3-methyl-5-(trifluoromethyl)pyrrolidin-2-one.
| Compound Name | (5R)-1-[(3-methoxyphenyl)methyl]-3-methyl-5-(trifluoromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 102390311 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (5R)-1-[(3-methoxyphenyl)methyl]-3-methyl-5-(trifluoromethyl)pyrrolidin-2-one |
| SMILES | COc1cccc(CN2C(=O)C(C)C[C@@H]2C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3NO2/c1-9-6-12(14(15,16)17)18(13(9)19)8-10-4-3-5-11(7-10)20-2/h3-5,7,9,12H,6,8H2,1-2H3/t9?,12-/m1/s1 |
| InChIKey | BUUTYVJYTFGKMO-FFFFSGIJSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |