C22H30ClN7O4 — CID 10239060
3,5-diamino-6-chloro-N-[N'-[4-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 10239060) has the molecular formula C22H30ClN7O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10239060 |
| Molecular Formula | C22H30ClN7O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CC1(C)OCC(COc2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)O1 |
| InChI | InChI=1S/C22H30ClN7O4/c1-22(2)33-12-15(34-22)11-32-14-8-6-13(7-9-14)5-3-4-10-27-21(26)30-20(31)16-18(24)29-19(25)17(23)28-16/h6-9,15H,3-5,10-12H2,1-2H3,(H4,24,25,29)(H3,26,27,30,31) |
| InChIKey | YZKCXYDEMSBHAV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|