About (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one
(3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one (PubChem CID 102391430) has the molecular formula C28H23FO5S2
and a molecular weight of 522.62 g/mol. Its IUPAC name is (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one.
Molecular Properties
| Compound Name | (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one |
| PubChem CID | 102391430 |
| Molecular Formula | C28H23FO5S2 |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one |
| SMILES | O=C(C[C@@H](c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23FO5S2/c29-28(35(31,32)24-17-9-3-10-18-24,36(33,34)25-19-11-4-12-20-25)26(22-13-5-1-6-14-22)21-27(30)23-15-7-2-8-16-23/h1-20,26H,21H2/t26-/m0/s1 |
| InChIKey | UWNSZQMSSLEJNS-SANMLTNESA-N |
| XLogP | 5.61 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one?
The IUPAC name of (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one (CID 102391430) is (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one.
What is the SMILES notation for (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one?
The canonical SMILES for (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one is O=C(C[C@@H](c1ccccc1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one?
The InChIKey is UWNSZQMSSLEJNS-SANMLTNESA-N. The full InChI is InChI=1S/C28H23FO5S2/c29-28(35(31,32)24-17-9-3-10-18-24,36(33,34)25-19-11-4-12-20-25)26(22-13-5-1-6-14-22)21-27(30)23-15-7-2-8-16-23/h1-20,26H,21H2/t26-/m0/s1.
What are the key properties of (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one?
(3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one has a molecular weight of 522.62 g/mol, XLogP of 5.61, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4,4-bis(benzenesulfonyl)-4-fluoro-1,3-diphenylbutan-1-one is sourced from PubChem (CID 102391430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).