About 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium
2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium (PubChem CID 102391499) has the molecular formula C12H21N2O+
and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium.
Molecular Properties
| Compound Name | 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium |
| PubChem CID | 102391499 |
| Molecular Formula | C12H21N2O+ |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)CCNC(=O)C1=CC=CC1 |
| InChI | InChI=1S/C12H20N2O/c1-4-14(2,3)10-9-13-12(15)11-7-5-6-8-11/h5-7H,4,8-10H2,1-3H3/p+1 |
| InChIKey | UZOZPSKCRYHSJO-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium?
The IUPAC name of 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium (CID 102391499) is 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium.
What is the SMILES notation for 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium?
The canonical SMILES for 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium is CC[N+](C)(C)CCNC(=O)C1=CC=CC1.
What is the InChIKey of 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium?
The InChIKey is UZOZPSKCRYHSJO-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H20N2O/c1-4-14(2,3)10-9-13-12(15)11-7-5-6-8-11/h5-7H,4,8-10H2,1-3H3/p+1.
What are the key properties of 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium?
2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium has a molecular weight of 209.31 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopenta-1,3-diene-1-carbonylamino)ethyl-ethyl-dimethylazanium is sourced from PubChem (CID 102391499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).