C28H22N4O8 — CID 102391608
dimethyl 3-cyano-7-[3-cyano-1,2-bis(ethoxycarbonyl)indolizin-7-yl]indolizine-1,2-dicarboxylate (PubChem CID 102391608) has the molecular formula C28H22N4O8 and a molecular weight of 542.50 g/mol. Its IUPAC name is dimethyl 3-cyano-7-[3-cyano-1,2-bis(ethoxycarbonyl)indolizin-7-yl]indolizine-1,2-dicarboxylate.
| Compound Name | dimethyl 3-cyano-7-[3-cyano-1,2-bis(ethoxycarbonyl)indolizin-7-yl]indolizine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102391608 |
| Molecular Formula | C28H22N4O8 |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | dimethyl 3-cyano-7-[3-cyano-1,2-bis(ethoxycarbonyl)indolizin-7-yl]indolizine-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c2cc(-c3ccn4c(C#N)c(C(=O)OC)c(C(=O)OC)c4c3)ccn2c1C#N |
| InChI | InChI=1S/C28H22N4O8/c1-5-39-27(35)22-18-12-16(8-10-32(18)20(14-30)24(22)28(36)40-6-2)15-7-9-31-17(11-15)21(25(33)37-3)23(19(31)13-29)26(34)38-4/h7-12H,5-6H2,1-4H3 |
| InChIKey | ROALURWZOYQATB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 161.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|