C9H9Cl3O3S — CID 102391918
ethyl (1S,3S,4S,5S)-3,7,7-trichloro-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylate (PubChem CID 102391918) has the molecular formula C9H9Cl3O3S and a molecular weight of 303.59 g/mol. Its IUPAC name is ethyl (1S,3S,4S,5S)-3,7,7-trichloro-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylate.
| Compound Name | ethyl (1S,3S,4S,5S)-3,7,7-trichloro-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylate |
|---|---|
| PubChem CID | 102391918 |
| Molecular Formula | C9H9Cl3O3S |
| Molecular Weight | 303.59 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | ethyl (1S,3S,4S,5S)-3,7,7-trichloro-6-oxo-2-thiabicyclo[3.2.0]heptane-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(=O)C(Cl)(Cl)[C@H]2S[C@H]1Cl |
| InChI | InChI=1S/C9H9Cl3O3S/c1-2-15-8(14)4-3-5(13)9(11,12)6(3)16-7(4)10/h3-4,6-7H,2H2,1H3/t3-,4+,6-,7+/m0/s1 |
| InChIKey | QBYBDGTZOFSGNL-VYFZPWGTSA-N |
| XLogP | 2.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|