C16H3F23O6S2 — CID 102392146
[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (PubChem CID 102392146) has the molecular formula C16H3F23O6S2 and a molecular weight of 792.28 g/mol. Its IUPAC name is [3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102392146 |
| Molecular Formula | C16H3F23O6S2 |
| Molecular Weight | 792.28 g/mol |
| Exact Mass | 791.90 |
| IUPAC Name | [3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-5-(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(OS(=O)(=O)C(F)(F)F)cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C16H3F23O6S2/c17-7(18,8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)13(29,30)14(31,32)33)4-1-5(44-46(40,41)15(34,35)36)3-6(2-4)45-47(42,43)16(37,38)39/h1-3H |
| InChIKey | VETFJQNIQIJLML-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.28 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|