C18H30O7 — CID 102392247
4-O-[(3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-oxoheptan-3-yl] 1-O-ethyl butanedioate (PubChem CID 102392247) has the molecular formula C18H30O7 and a molecular weight of 358.43 g/mol. Its IUPAC name is 4-O-[(3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-oxoheptan-3-yl] 1-O-ethyl butanedioate.
| Compound Name | 4-O-[(3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-oxoheptan-3-yl] 1-O-ethyl butanedioate |
|---|---|
| PubChem CID | 102392247 |
| Molecular Formula | C18H30O7 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 4-O-[(3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-oxoheptan-3-yl] 1-O-ethyl butanedioate |
| SMILES | CCCC[C@](CC=O)(OC(=O)CCC(=O)OCC)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H30O7/c1-5-7-10-18(11-12-19,14-13-23-17(3,4)24-14)25-16(21)9-8-15(20)22-6-2/h12,14H,5-11,13H2,1-4H3/t14-,18+/m0/s1 |
| InChIKey | KDESSTMVCKNXLZ-KBXCAEBGSA-N |
| XLogP | 2.54 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|