C29H36N4O2S — CID 10239231
2-[[1-(3-benzyl-4-oxothieno[2,3-d]pyrimidin-2-yl)-2-methylpropyl]-[(4-methylphenyl)methyl]amino]-N,N-dimethylethanamine oxide (PubChem CID 10239231) has the molecular formula C29H36N4O2S and a molecular weight of 504.70 g/mol. Its IUPAC name is 2-[[1-(3-benzyl-4-oxothieno[2,3-d]pyrimidin-2-yl)-2-methylpropyl]-[(4-methylphenyl)methyl]amino]-N,N-dimethylethanamine oxide.
| Compound Name | 2-[[1-(3-benzyl-4-oxothieno[2,3-d]pyrimidin-2-yl)-2-methylpropyl]-[(4-methylphenyl)methyl]amino]-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 10239231 |
| Molecular Formula | C29H36N4O2S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 2-[[1-(3-benzyl-4-oxothieno[2,3-d]pyrimidin-2-yl)-2-methylpropyl]-[(4-methylphenyl)methyl]amino]-N,N-dimethylethanamine oxide |
| SMILES | Cc1ccc(CN(CC[N+](C)(C)[O-])C(c2nc3sccc3c(=O)n2Cc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C29H36N4O2S/c1-21(2)26(31(16-17-33(4,5)35)19-24-13-11-22(3)12-14-24)27-30-28-25(15-18-36-28)29(34)32(27)20-23-9-7-6-8-10-23/h6-15,18,21,26H,16-17,19-20H2,1-5H3 |
| InChIKey | BYEJVDJOVHWXCO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|