C25H29NO — CID 102392591
(3aS)-2,3-diphenylspiro[5,6,7,8-tetrahydro-3aH-[1,2]oxazolo[2,3-a]azepine-4,1'-cyclohexane] (PubChem CID 102392591) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is (3aS)-2,3-diphenylspiro[5,6,7,8-tetrahydro-3aH-[1,2]oxazolo[2,3-a]azepine-4,1'-cyclohexane].
| Compound Name | (3aS)-2,3-diphenylspiro[5,6,7,8-tetrahydro-3aH-[1,2]oxazolo[2,3-a]azepine-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 102392591 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (3aS)-2,3-diphenylspiro[5,6,7,8-tetrahydro-3aH-[1,2]oxazolo[2,3-a]azepine-4,1'-cyclohexane] |
| SMILES | c1ccc(C2=C(c3ccccc3)[C@H]3N(CCCCC34CCCCC4)O2)cc1 |
| InChI | InChI=1S/C25H29NO/c1-4-12-20(13-5-1)22-23(21-14-6-2-7-15-21)27-26-19-11-10-18-25(24(22)26)16-8-3-9-17-25/h1-2,4-7,12-15,24H,3,8-11,16-19H2/t24-/m1/s1 |
| InChIKey | GDWTUKKESZFUAV-XMMPIXPASA-N |
| XLogP | 6.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|