C51H90N12O10 — CID 102393078
[(2R,3R,4S,5R,6S)-3,4,5-tris(11-azidoundecanoyloxy)-6-methoxyoxan-2-yl]methyl 11-azidoundecanoate (PubChem CID 102393078) has the molecular formula C51H90N12O10 and a molecular weight of 1031.35 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tris(11-azidoundecanoyloxy)-6-methoxyoxan-2-yl]methyl 11-azidoundecanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(11-azidoundecanoyloxy)-6-methoxyoxan-2-yl]methyl 11-azidoundecanoate |
|---|---|
| PubChem CID | 102393078 |
| Molecular Formula | C51H90N12O10 |
| Molecular Weight | 1031.35 g/mol |
| Exact Mass | 1030.69 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(11-azidoundecanoyloxy)-6-methoxyoxan-2-yl]methyl 11-azidoundecanoate |
| SMILES | CO[C@H]1O[C@H](COC(=O)CCCCCCCCCCN=[N+]=[N-])[C@@H](OC(=O)CCCCCCCCCCN=[N+]=[N-])[C@H](OC(=O)CCCCCCCCCCN=[N+]=[N-])[C@H]1OC(=O)CCCCCCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C51H90N12O10/c1-68-51-50(73-47(67)37-29-21-13-5-9-17-25-33-41-59-63-55)49(72-46(66)36-28-20-12-4-8-16-24-32-40-58-62-54)48(71-45(65)35-27-19-11-3-7-15-23-31-39-57-61-53)43(70-51)42-69-44(64)34-26-18-10-2-6-14-22-30-38-56-60-52/h43,48-51H,2-42H2,1H3/t43-,48-,49+,50-,51+/m1/s1 |
| InChIKey | KSLMHLFAPQOVRK-UVNJUYEKSA-N |
| XLogP | 14.92 |
| TPSA | 318.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.35 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|