About 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane
2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane (PubChem CID 102393103) has the molecular formula C24H36Si2
and a molecular weight of 380.72 g/mol. Its IUPAC name is 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane |
| PubChem CID | 102393103 |
| Molecular Formula | C24H36Si2 |
| Molecular Weight | 380.72 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane |
| SMILES | C=CCC1=C(C#C[Si](C(C)C)(C(C)C)C(C)C)[Si](C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H36Si2/c1-10-13-21-22-14-11-12-15-23(22)25(8,9)24(21)16-17-26(18(2)3,19(4)5)20(6)7/h10-12,14-15,18-20H,1,13H2,2-9H3 |
| InChIKey | SYWGTYMDHZDOJT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.72 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane?
The IUPAC name of 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane (CID 102393103) is 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane.
What is the SMILES notation for 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane?
The canonical SMILES for 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane is C=CCC1=C(C#C[Si](C(C)C)(C(C)C)C(C)C)[Si](C)(C)c2ccccc21.
What is the InChIKey of 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane?
The InChIKey is SYWGTYMDHZDOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36Si2/c1-10-13-21-22-14-11-12-15-23(22)25(8,9)24(21)16-17-26(18(2)3,19(4)5)20(6)7/h10-12,14-15,18-20H,1,13H2,2-9H3.
What are the key properties of 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane?
2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane has a molecular weight of 380.72 g/mol, XLogP of 6.71, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dimethyl-3-prop-2-enyl-1-benzosilol-2-yl)ethynyl-tri(propan-2-yl)silane is sourced from PubChem (CID 102393103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).