C20H22OSi — CID 102393106
2-(3-methoxyphenyl)-1,1-dimethyl-3-prop-2-enyl-1-benzosilole (PubChem CID 102393106) has the molecular formula C20H22OSi and a molecular weight of 306.48 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1,1-dimethyl-3-prop-2-enyl-1-benzosilole.
| Compound Name | 2-(3-methoxyphenyl)-1,1-dimethyl-3-prop-2-enyl-1-benzosilole |
|---|---|
| PubChem CID | 102393106 |
| Molecular Formula | C20H22OSi |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-(3-methoxyphenyl)-1,1-dimethyl-3-prop-2-enyl-1-benzosilole |
| SMILES | C=CCC1=C(c2cccc(OC)c2)[Si](C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H22OSi/c1-5-9-18-17-12-6-7-13-19(17)22(3,4)20(18)15-10-8-11-16(14-15)21-2/h5-8,10-14H,1,9H2,2-4H3 |
| InChIKey | ITQHCCXPIBTYJP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|