About 2-methylpropylgermane
2-methylpropylgermane (PubChem CID 102393253) has the molecular formula C4H12Ge
and a molecular weight of 132.75 g/mol. Its IUPAC name is 2-methylpropylgermane.
Molecular Properties
| Compound Name | 2-methylpropylgermane |
| PubChem CID | 102393253 |
| Molecular Formula | C4H12Ge |
| Molecular Weight | 132.75 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | 2-methylpropylgermane |
| SMILES | CC(C)C[GeH3] |
| InChI | InChI=1S/C4H12Ge/c1-4(2)3-5/h4H,3H2,1-2,5H3 |
| InChIKey | PILXXBFWCYMNMX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.75 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylpropylgermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropylgermane?
The IUPAC name of 2-methylpropylgermane (CID 102393253) is 2-methylpropylgermane.
What is the SMILES notation for 2-methylpropylgermane?
The canonical SMILES for 2-methylpropylgermane is CC(C)C[GeH3].
What is the InChIKey of 2-methylpropylgermane?
The InChIKey is PILXXBFWCYMNMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12Ge/c1-4(2)3-5/h4H,3H2,1-2,5H3.
What are the key properties of 2-methylpropylgermane?
2-methylpropylgermane has a molecular weight of 132.75 g/mol, XLogP of 0.43, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropylgermane is sourced from PubChem (CID 102393253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).