C17H17N3O2S — CID 102393293
ethyl 6-methyl-4-quinolin-3-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 102393293) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is ethyl 6-methyl-4-quinolin-3-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-methyl-4-quinolin-3-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102393293 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | ethyl 6-methyl-4-quinolin-3-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)NC1c1cnc2ccccc2c1 |
| InChI | InChI=1S/C17H17N3O2S/c1-3-22-16(21)14-10(2)19-17(23)20-15(14)12-8-11-6-4-5-7-13(11)18-9-12/h4-9,15H,3H2,1-2H3,(H2,19,20,23) |
| InChIKey | NRJWDSACEWISAQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|