C17H24N2 — CID 102394184
1-(8-phenyloctyl)imidazole (PubChem CID 102394184) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-(8-phenyloctyl)imidazole.
| Compound Name | 1-(8-phenyloctyl)imidazole |
|---|---|
| PubChem CID | 102394184 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-(8-phenyloctyl)imidazole |
| SMILES | c1ccc(CCCCCCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C17H24N2/c1(2-4-9-14-19-15-13-18-16-19)3-6-10-17-11-7-5-8-12-17/h5,7-8,11-13,15-16H,1-4,6,9-10,14H2 |
| InChIKey | RJOPLMWRZIJXRU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|