C12H15F3O3 — CID 102394457
(1R,2S,6R,7S)-1,10,10-trimethyl-2-(trifluoromethyl)-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 102394457) has the molecular formula C12H15F3O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is (1R,2S,6R,7S)-1,10,10-trimethyl-2-(trifluoromethyl)-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one.
| Compound Name | (1R,2S,6R,7S)-1,10,10-trimethyl-2-(trifluoromethyl)-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one |
|---|---|
| PubChem CID | 102394457 |
| Molecular Formula | C12H15F3O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (1R,2S,6R,7S)-1,10,10-trimethyl-2-(trifluoromethyl)-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@]1(C(F)(F)F)OC(=O)O[C@H]21 |
| InChI | InChI=1S/C12H15F3O3/c1-9(2)6-4-5-10(9,3)11(12(13,14)15)7(6)17-8(16)18-11/h6-7H,4-5H2,1-3H3/t6-,7-,10-,11-/m1/s1 |
| InChIKey | LOFHQCHUJOSNGF-JJHYMCDRSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |