C11H18O — CID 102394793
(3aR,4S,7aR)-4-ethyl-7a-methyl-3,3a,4,7-tetrahydro-2H-1-benzofuran (PubChem CID 102394793) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (3aR,4S,7aR)-4-ethyl-7a-methyl-3,3a,4,7-tetrahydro-2H-1-benzofuran.
| Compound Name | (3aR,4S,7aR)-4-ethyl-7a-methyl-3,3a,4,7-tetrahydro-2H-1-benzofuran |
|---|---|
| PubChem CID | 102394793 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (3aR,4S,7aR)-4-ethyl-7a-methyl-3,3a,4,7-tetrahydro-2H-1-benzofuran |
| SMILES | CC[C@H]1C=CC[C@@]2(C)OCC[C@H]12 |
| InChI | InChI=1S/C11H18O/c1-3-9-5-4-7-11(2)10(9)6-8-12-11/h4-5,9-10H,3,6-8H2,1-2H3/t9-,10+,11+/m0/s1 |
| InChIKey | KKVKJJLPCYFKKR-HBNTYKKESA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|