C26H28O3 — CID 102394821
ethyl (1R,5S,6Z)-6-benzylidene-4-ethyl-1,3-dimethyl-2-oxo-5-phenylcyclohex-3-ene-1-carboxylate (PubChem CID 102394821) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is ethyl (1R,5S,6Z)-6-benzylidene-4-ethyl-1,3-dimethyl-2-oxo-5-phenylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,5S,6Z)-6-benzylidene-4-ethyl-1,3-dimethyl-2-oxo-5-phenylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102394821 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | ethyl (1R,5S,6Z)-6-benzylidene-4-ethyl-1,3-dimethyl-2-oxo-5-phenylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C(=O)C(C)=C(CC)[C@H](c2ccccc2)/C1=C/c1ccccc1 |
| InChI | InChI=1S/C26H28O3/c1-5-21-18(3)24(27)26(4,25(28)29-6-2)22(17-19-13-9-7-10-14-19)23(21)20-15-11-8-12-16-20/h7-17,23H,5-6H2,1-4H3/b22-17-/t23-,26+/m0/s1 |
| InChIKey | TUHZYYRRNLNDLX-JEIPJYKLSA-N |
| XLogP | 5.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|