C28H32O3 — CID 102394822
ethyl (1R,5S,6Z)-6-benzylidene-4-butyl-1,3-dimethyl-2-oxo-5-phenylcyclohex-3-ene-1-carboxylate (PubChem CID 102394822) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is ethyl (1R,5S,6Z)-6-benzylidene-4-butyl-1,3-dimethyl-2-oxo-5-phenylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,5S,6Z)-6-benzylidene-4-butyl-1,3-dimethyl-2-oxo-5-phenylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102394822 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | ethyl (1R,5S,6Z)-6-benzylidene-4-butyl-1,3-dimethyl-2-oxo-5-phenylcyclohex-3-ene-1-carboxylate |
| SMILES | CCCCC1=C(C)C(=O)[C@](C)(C(=O)OCC)/C(=C\c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H32O3/c1-5-7-18-23-20(3)26(29)28(4,27(30)31-6-2)24(19-21-14-10-8-11-15-21)25(23)22-16-12-9-13-17-22/h8-17,19,25H,5-7,18H2,1-4H3/b24-19-/t25-,28+/m0/s1 |
| InChIKey | YWLKWIAZKSCRNG-CCISDCSOSA-N |
| XLogP | 6.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|