About N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide
N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide (PubChem CID 102395215) has the molecular formula C17H16N4O2
and a molecular weight of 308.34 g/mol. Its IUPAC name is N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 102395215 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC1=CC=CC1)Nc1ccccc1NC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C17H16N4O2/c22-16(15-10-5-11-18-15)20-13-8-3-4-9-14(13)21-17(23)19-12-6-1-2-7-12/h1-6,8-11,18H,7H2,(H,20,22)(H2,19,21,23) |
| InChIKey | ADPGWZOLTWDSSD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide?
The IUPAC name of N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide (CID 102395215) is N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide is O=C(NC1=CC=CC1)Nc1ccccc1NC(=O)c1ccc[nH]1.
What is the InChIKey of N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide?
The InChIKey is ADPGWZOLTWDSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O2/c22-16(15-10-5-11-18-15)20-13-8-3-4-9-14(13)21-17(23)19-12-6-1-2-7-12/h1-6,8-11,18H,7H2,(H,20,22)(H2,19,21,23).
What are the key properties of N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide?
N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide has a molecular weight of 308.34 g/mol, XLogP of 3.23, 4 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(cyclopenta-1,3-dien-1-ylcarbamoylamino)phenyl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 102395215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).