C15H21N11 — CID 102395318
11-(2-azidoethyl)-3-prop-2-ynyl-3,6,7,8,11,14,15,16-octazatricyclo[12.2.1.15,8]octadeca-1(17),5(18),6,15-tetraene (PubChem CID 102395318) has the molecular formula C15H21N11 and a molecular weight of 355.41 g/mol. Its IUPAC name is 11-(2-azidoethyl)-3-prop-2-ynyl-3,6,7,8,11,14,15,16-octazatricyclo[12.2.1.15,8]octadeca-1(17),5(18),6,15-tetraene.
| Compound Name | 11-(2-azidoethyl)-3-prop-2-ynyl-3,6,7,8,11,14,15,16-octazatricyclo[12.2.1.15,8]octadeca-1(17),5(18),6,15-tetraene |
|---|---|
| PubChem CID | 102395318 |
| Molecular Formula | C15H21N11 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 11-(2-azidoethyl)-3-prop-2-ynyl-3,6,7,8,11,14,15,16-octazatricyclo[12.2.1.15,8]octadeca-1(17),5(18),6,15-tetraene |
| SMILES | C#CCN1Cc2cn(nn2)CCN(CCN=[N+]=[N-])CCn2cc(nn2)C1 |
| InChI | InChI=1S/C15H21N11/c1-2-4-24-10-14-12-25(21-18-14)8-6-23(5-3-17-20-16)7-9-26-13-15(11-24)19-22-26/h1,12-13H,3-11H2 |
| InChIKey | SEJZYJKKXQOQLF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 116.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|