C22H34O5 — CID 102395381
ethyl 2-[(1R,3S,4E,7E,12R)-3,12-dihydroxy-4,8,12-trimethyl-11-oxocyclotetradeca-4,7-dien-1-yl]prop-2-enoate (PubChem CID 102395381) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is ethyl 2-[(1R,3S,4E,7E,12R)-3,12-dihydroxy-4,8,12-trimethyl-11-oxocyclotetradeca-4,7-dien-1-yl]prop-2-enoate.
| Compound Name | ethyl 2-[(1R,3S,4E,7E,12R)-3,12-dihydroxy-4,8,12-trimethyl-11-oxocyclotetradeca-4,7-dien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102395381 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | ethyl 2-[(1R,3S,4E,7E,12R)-3,12-dihydroxy-4,8,12-trimethyl-11-oxocyclotetradeca-4,7-dien-1-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H]1CC[C@@](C)(O)C(=O)CC/C(C)=C/C/C=C(\C)[C@@H](O)C1 |
| InChI | InChI=1S/C22H34O5/c1-6-27-21(25)17(4)18-12-13-22(5,26)20(24)11-10-15(2)8-7-9-16(3)19(23)14-18/h8-9,18-19,23,26H,4,6-7,10-14H2,1-3,5H3/b15-8+,16-9+/t18-,19+,22-/m1/s1 |
| InChIKey | DDVQLQBZUYJIOQ-OJCJVJNSSA-N |
| XLogP | 3.65 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|