C17H20BrNO3 — CID 102395682
tert-butyl (2R)-5-bromo-2-[(E)-3-oxobut-1-enyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 102395682) has the molecular formula C17H20BrNO3 and a molecular weight of 366.26 g/mol. Its IUPAC name is tert-butyl (2R)-5-bromo-2-[(E)-3-oxobut-1-enyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl (2R)-5-bromo-2-[(E)-3-oxobut-1-enyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 102395682 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | tert-butyl (2R)-5-bromo-2-[(E)-3-oxobut-1-enyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(=O)/C=C/[C@H]1Cc2cc(Br)ccc2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H20BrNO3/c1-11(20)5-7-14-10-12-9-13(18)6-8-15(12)19(14)16(21)22-17(2,3)4/h5-9,14H,10H2,1-4H3/b7-5+/t14-/m0/s1 |
| InChIKey | YBBWTQFWYITOJP-DYLGSBMWSA-N |
| XLogP | 4.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|