C16H23N3O8P2 — CID 102395906
[(2E,6E)-8-(3-azidophenoxy)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate (PubChem CID 102395906) has the molecular formula C16H23N3O8P2 and a molecular weight of 447.32 g/mol. Its IUPAC name is [(2E,6E)-8-(3-azidophenoxy)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-8-(3-azidophenoxy)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 102395906 |
| Molecular Formula | C16H23N3O8P2 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [(2E,6E)-8-(3-azidophenoxy)-3,7-dimethylocta-2,6-dienyl] phosphono hydrogen phosphate |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CC/C=C(\C)COc1cccc(N=[N+]=[N-])c1 |
| InChI | InChI=1S/C16H23N3O8P2/c1-13(9-10-26-29(23,24)27-28(20,21)22)5-3-6-14(2)12-25-16-8-4-7-15(11-16)18-19-17/h4,6-9,11H,3,5,10,12H2,1-2H3,(H,23,24)(H2,20,21,22)/b13-9+,14-6+ |
| InChIKey | OCHILLNONNMDQC-WSPXSRFVSA-N |
| XLogP | 4.91 |
| TPSA | 171.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|