C16H12N2O2 — CID 102395942
[(2aR,4S)-5,8-dicyano-2a,3,4,8b-tetrahydrocyclobuta[a]naphthalen-4-yl] acetate (PubChem CID 102395942) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is [(2aR,4S)-5,8-dicyano-2a,3,4,8b-tetrahydrocyclobuta[a]naphthalen-4-yl] acetate.
| Compound Name | [(2aR,4S)-5,8-dicyano-2a,3,4,8b-tetrahydrocyclobuta[a]naphthalen-4-yl] acetate |
|---|---|
| PubChem CID | 102395942 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | [(2aR,4S)-5,8-dicyano-2a,3,4,8b-tetrahydrocyclobuta[a]naphthalen-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H]2C=CC2c2c(C#N)ccc(C#N)c21 |
| InChI | InChI=1S/C16H12N2O2/c1-9(19)20-14-6-10-4-5-13(10)15-11(7-17)2-3-12(8-18)16(14)15/h2-5,10,13-14H,6H2,1H3/t10-,13?,14-/m0/s1 |
| InChIKey | IBBUTPVTYCUAJK-LZRTYROISA-N |
| XLogP | 2.71 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|