C14H8N2 — CID 102395954
tetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-9,12-dicarbonitrile (PubChem CID 102395954) has the molecular formula C14H8N2 and a molecular weight of 204.23 g/mol. Its IUPAC name is tetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-9,12-dicarbonitrile.
| Compound Name | tetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-9,12-dicarbonitrile |
|---|---|
| PubChem CID | 102395954 |
| Molecular Formula | C14H8N2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | tetracyclo[6.4.0.02,4.03,7]dodeca-1(12),5,8,10-tetraene-9,12-dicarbonitrile |
| SMILES | N#Cc1ccc(C#N)c2c1C1C=CC3C2C13 |
| InChI | InChI=1S/C14H8N2/c15-5-7-1-2-8(6-16)12-11(7)9-3-4-10-13(9)14(10)12/h1-4,9-10,13-14H |
| InChIKey | VEVWBURKJMEPKR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|