C13H29N6+ — CID 102396066
1-N,5-N,3-tritert-butyltetrazol-3-ium-1,5-diamine (PubChem CID 102396066) has the molecular formula C13H29N6+ and a molecular weight of 269.42 g/mol. Its IUPAC name is 1-N,5-N,3-tritert-butyltetrazol-3-ium-1,5-diamine.
| Compound Name | 1-N,5-N,3-tritert-butyltetrazol-3-ium-1,5-diamine |
|---|---|
| PubChem CID | 102396066 |
| Molecular Formula | C13H29N6+ |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 1-N,5-N,3-tritert-butyltetrazol-3-ium-1,5-diamine |
| SMILES | CC(C)(C)Nc1n[n+](C(C)(C)C)nn1NC(C)(C)C |
| InChI | InChI=1S/C13H29N6/c1-11(2,3)14-10-15-19(13(7,8)9)17-18(10)16-12(4,5)6/h1-9H3,(H2,14,15,16,17)/q+1 |
| InChIKey | LNYMJCPDOZDXKP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|