C25H23N3OS2 — CID 102396222
2-(4-tert-butylphenoxy)-4,6-bis(phenylsulfanyl)-1,3,5-triazine (PubChem CID 102396222) has the molecular formula C25H23N3OS2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-4,6-bis(phenylsulfanyl)-1,3,5-triazine.
| Compound Name | 2-(4-tert-butylphenoxy)-4,6-bis(phenylsulfanyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 102396222 |
| Molecular Formula | C25H23N3OS2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-4,6-bis(phenylsulfanyl)-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(Oc2nc(Sc3ccccc3)nc(Sc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H23N3OS2/c1-25(2,3)18-14-16-19(17-15-18)29-22-26-23(30-20-10-6-4-7-11-20)28-24(27-22)31-21-12-8-5-9-13-21/h4-17H,1-3H3 |
| InChIKey | SRJWRKZGQMALOG-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |