C19H32O3 — CID 102396306
(4R)-4-decyl-2-hydroxy-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 102396306) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (4R)-4-decyl-2-hydroxy-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | (4R)-4-decyl-2-hydroxy-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 102396306 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (4R)-4-decyl-2-hydroxy-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CCCCCCCCCC[C@@H]1CC(O)OC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C19H32O3/c1-2-3-4-5-6-7-8-9-11-15-14-18(21)22-17-13-10-12-16(20)19(15)17/h15,18,21H,2-14H2,1H3/t15-,18?/m1/s1 |
| InChIKey | OCOLMBHPQQAKFY-NNJIEVJOSA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|