C18H30O3 — CID 102396315
(4R)-4-heptyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one (PubChem CID 102396315) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (4R)-4-heptyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one.
| Compound Name | (4R)-4-heptyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one |
|---|---|
| PubChem CID | 102396315 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (4R)-4-heptyl-2-hydroxy-7,7-dimethyl-3,4,6,8-tetrahydro-2H-chromen-5-one |
| SMILES | CCCCCCC[C@@H]1CC(O)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C18H30O3/c1-4-5-6-7-8-9-13-10-16(20)21-15-12-18(2,3)11-14(19)17(13)15/h13,16,20H,4-12H2,1-3H3/t13-,16?/m1/s1 |
| InChIKey | JRCMHBIPPRABCQ-JBZHPUCOSA-N |
| XLogP | 4.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|