About 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline
4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline (PubChem CID 102396363) has the molecular formula C18H14N4S
and a molecular weight of 318.41 g/mol. Its IUPAC name is 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline.
Molecular Properties
| Compound Name | 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline |
| PubChem CID | 102396363 |
| Molecular Formula | C18H14N4S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3ccc(N)cc3)c3nsnc23)cc1 |
| InChI | InChI=1S/C18H14N4S/c19-13-5-1-11(2-6-13)15-9-10-16(18-17(15)21-23-22-18)12-3-7-14(20)8-4-12/h1-10H,19-20H2 |
| InChIKey | JVODNHZESHSUJN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline?
The IUPAC name of 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline (CID 102396363) is 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline.
What is the SMILES notation for 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline?
The canonical SMILES for 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline is Nc1ccc(-c2ccc(-c3ccc(N)cc3)c3nsnc23)cc1.
What is the InChIKey of 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline?
The InChIKey is JVODNHZESHSUJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4S/c19-13-5-1-11(2-6-13)15-9-10-16(18-17(15)21-23-22-18)12-3-7-14(20)8-4-12/h1-10H,19-20H2.
What are the key properties of 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline?
4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline has a molecular weight of 318.41 g/mol, XLogP of 4.19, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-aminophenyl)-2,1,3-benzothiadiazol-7-yl]aniline is sourced from PubChem (CID 102396363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).