C15H24O3Si — CID 102396839
(3S,6R,6aR)-3-[(E)-but-2-enoxy]-6-methyl-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 102396839) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is (3S,6R,6aR)-3-[(E)-but-2-enoxy]-6-methyl-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (3S,6R,6aR)-3-[(E)-but-2-enoxy]-6-methyl-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 102396839 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (3S,6R,6aR)-3-[(E)-but-2-enoxy]-6-methyl-4-trimethylsilyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | C/C=C/CO[C@H]1OC[C@H]2C1=C([Si](C)(C)C)C(=O)[C@@H]2C |
| InChI | InChI=1S/C15H24O3Si/c1-6-7-8-17-15-12-11(9-18-15)10(2)13(16)14(12)19(3,4)5/h6-7,10-11,15H,8-9H2,1-5H3/b7-6+/t10-,11-,15+/m1/s1 |
| InChIKey | HRBODIZKEKXIOO-DJCMKREWSA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|