C22H41BO4Si — CID 102396891
(E)-8-[tert-butyl(dimethyl)silyl]oxy-7-methylidene-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-en-2-one (PubChem CID 102396891) has the molecular formula C22H41BO4Si and a molecular weight of 408.46 g/mol. Its IUPAC name is (E)-8-[tert-butyl(dimethyl)silyl]oxy-7-methylidene-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-en-2-one.
| Compound Name | (E)-8-[tert-butyl(dimethyl)silyl]oxy-7-methylidene-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-en-2-one |
|---|---|
| PubChem CID | 102396891 |
| Molecular Formula | C22H41BO4Si |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (E)-8-[tert-butyl(dimethyl)silyl]oxy-7-methylidene-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)non-5-en-2-one |
| SMILES | C=C(/C(=C/CCC(C)=O)B1OC(C)(C)C(C)(C)O1)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41BO4Si/c1-16(24)14-13-15-19(23-26-21(7,8)22(9,10)27-23)17(2)18(3)25-28(11,12)20(4,5)6/h15,18H,2,13-14H2,1,3-12H3/b19-15- |
| InChIKey | CGUWSFCYSDDRID-CYVLTUHYSA-N |
| XLogP | 5.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|