C22H41BO3Si — CID 102396900
tert-butyl-dimethyl-[(4E)-3-methylidene-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nona-4,8-dien-2-yl]oxysilane (PubChem CID 102396900) has the molecular formula C22H41BO3Si and a molecular weight of 392.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4E)-3-methylidene-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nona-4,8-dien-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(4E)-3-methylidene-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nona-4,8-dien-2-yl]oxysilane |
|---|---|
| PubChem CID | 102396900 |
| Molecular Formula | C22H41BO3Si |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | tert-butyl-dimethyl-[(4E)-3-methylidene-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nona-4,8-dien-2-yl]oxysilane |
| SMILES | C=CCC/C=C(\B1OC(C)(C)C(C)(C)O1)C(=C)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41BO3Si/c1-13-14-15-16-19(23-25-21(7,8)22(9,10)26-23)17(2)18(3)24-27(11,12)20(4,5)6/h13,16,18H,1-2,14-15H2,3-12H3/b19-16- |
| InChIKey | YIOANRUKAXVTFW-MNDPQUGUSA-N |
| XLogP | 6.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|