C18H34O6Si — CID 102397273
(2S)-3-[(2S,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-oxooxan-2-yl]-2-(methoxymethoxy)propanal (PubChem CID 102397273) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is (2S)-3-[(2S,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-oxooxan-2-yl]-2-(methoxymethoxy)propanal.
| Compound Name | (2S)-3-[(2S,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-oxooxan-2-yl]-2-(methoxymethoxy)propanal |
|---|---|
| PubChem CID | 102397273 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (2S)-3-[(2S,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-oxooxan-2-yl]-2-(methoxymethoxy)propanal |
| SMILES | COCO[C@H](C=O)C[C@@H]1OC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C18H34O6Si/c1-12-15(9-14(10-19)22-11-21-6)23-17(20)13(2)16(12)24-25(7,8)18(3,4)5/h10,12-16H,9,11H2,1-8H3/t12-,13+,14-,15-,16-/m0/s1 |
| InChIKey | IXGUUDPAXHCIRT-QRJUGERDSA-N |
| XLogP | 3.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|