C23H14F3N3O2 — CID 102397276
4-methyl-8,11-diphenyl-13-(trifluoromethyl)-5-oxa-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 102397276) has the molecular formula C23H14F3N3O2 and a molecular weight of 421.38 g/mol. Its IUPAC name is 4-methyl-8,11-diphenyl-13-(trifluoromethyl)-5-oxa-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 4-methyl-8,11-diphenyl-13-(trifluoromethyl)-5-oxa-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 102397276 |
| Molecular Formula | C23H14F3N3O2 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 4-methyl-8,11-diphenyl-13-(trifluoromethyl)-5-oxa-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | Cc1nc2c3c(C(F)(F)F)cc(-c4ccccc4)nc3n(-c3ccccc3)c2c(=O)o1 |
| InChI | InChI=1S/C23H14F3N3O2/c1-13-27-19-18-16(23(24,25)26)12-17(14-8-4-2-5-9-14)28-21(18)29(20(19)22(30)31-13)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | PUDDBXGSLYZKNT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |