C17H26O6 — CID 102397902
[(1R,4R,6S,8R,9R,10S,11S)-6-formyl-10-hydroxy-1-methyl-9-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-8-yl] acetate (PubChem CID 102397902) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is [(1R,4R,6S,8R,9R,10S,11S)-6-formyl-10-hydroxy-1-methyl-9-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-8-yl] acetate.
| Compound Name | [(1R,4R,6S,8R,9R,10S,11S)-6-formyl-10-hydroxy-1-methyl-9-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-8-yl] acetate |
|---|---|
| PubChem CID | 102397902 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [(1R,4R,6S,8R,9R,10S,11S)-6-formyl-10-hydroxy-1-methyl-9-propan-2-yl-5,12-dioxatricyclo[9.1.0.04,6]dodecan-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@]2(C=O)O[C@@H]2CC[C@@]2(C)O[C@H]2[C@@H](O)[C@H]1C(C)C |
| InChI | InChI=1S/C17H26O6/c1-9(2)13-11(21-10(3)19)7-17(8-18)12(22-17)5-6-16(4)15(23-16)14(13)20/h8-9,11-15,20H,5-7H2,1-4H3/t11-,12-,13+,14+,15+,16-,17-/m1/s1 |
| InChIKey | VOWGEZVKTJIMKD-BEPHGODMSA-N |
| XLogP | 1.23 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|